C14H21IO2 — CID 23015316
4-tert-butyl-2-(1,1-dimethoxyethyl)-1-iodobenzene (PubChem CID 23015316) has the molecular formula C14H21IO2 and a molecular weight of 348.22 g/mol. Its IUPAC name is 4-tert-butyl-2-(1,1-dimethoxyethyl)-1-iodobenzene.
| Compound Name | 4-tert-butyl-2-(1,1-dimethoxyethyl)-1-iodobenzene |
|---|---|
| PubChem CID | 23015316 |
| Molecular Formula | C14H21IO2 |
| Molecular Weight | 348.22 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | 4-tert-butyl-2-(1,1-dimethoxyethyl)-1-iodobenzene |
| SMILES | COC(C)(OC)c1cc(C(C)(C)C)ccc1I |
| InChI | InChI=1S/C14H21IO2/c1-13(2,3)10-7-8-12(15)11(9-10)14(4,16-5)17-6/h7-9H,1-6H3 |
| InChIKey | JMVJPTLJDFGRJB-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.22 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|