C18H28N3O4SY- — CID 156863401
[5-[2-[2-(dimethylamino)ethoxy]ethoxy]-6-methoxy-1,3-benzothiazol-2-yl]methyl-propan-2-yloxyazanide;yttrium (PubChem CID 156863401) has the molecular formula C18H28N3O4SY- and a molecular weight of 471.41 g/mol. Its IUPAC name is [5-[2-[2-(dimethylamino)ethoxy]ethoxy]-6-methoxy-1,3-benzothiazol-2-yl]methyl-propan-2-yloxyazanide;yttrium.
| Compound Name | [5-[2-[2-(dimethylamino)ethoxy]ethoxy]-6-methoxy-1,3-benzothiazol-2-yl]methyl-propan-2-yloxyazanide;yttrium |
|---|---|
| PubChem CID | 156863401 |
| Molecular Formula | C18H28N3O4SY- |
| Molecular Weight | 471.41 g/mol |
| Exact Mass | 471.09 |
| IUPAC Name | [5-[2-[2-(dimethylamino)ethoxy]ethoxy]-6-methoxy-1,3-benzothiazol-2-yl]methyl-propan-2-yloxyazanide;yttrium |
| SMILES | COc1cc2sc(C[N-]OC(C)C)nc2cc1OCCOCCN(C)C.[Y] |
| InChI | InChI=1S/C18H28N3O4S.Y/c1-13(2)25-19-12-18-20-14-10-16(15(22-5)11-17(14)26-18)24-9-8-23-7-6-21(3)4;/h10-11,13H,6-9,12H2,1-5H3;/q-1; |
| InChIKey | NKMJGNNFRCCZPA-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.41 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|