C18H26N2O8 — CID 10597000
2-[2-[3-[2-(2-hydroxyethoxy)ethoxy]-6,7-dimethoxyquinoxalin-2-yl]oxyethoxy]ethanol (PubChem CID 10597000) has the molecular formula C18H26N2O8 and a molecular weight of 398.41 g/mol. Its IUPAC name is 2-[2-[3-[2-(2-hydroxyethoxy)ethoxy]-6,7-dimethoxyquinoxalin-2-yl]oxyethoxy]ethanol.
| Compound Name | 2-[2-[3-[2-(2-hydroxyethoxy)ethoxy]-6,7-dimethoxyquinoxalin-2-yl]oxyethoxy]ethanol |
|---|---|
| PubChem CID | 10597000 |
| Molecular Formula | C18H26N2O8 |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | 2-[2-[3-[2-(2-hydroxyethoxy)ethoxy]-6,7-dimethoxyquinoxalin-2-yl]oxyethoxy]ethanol |
| SMILES | COc1cc2nc(OCCOCCO)c(OCCOCCO)nc2cc1OC |
| InChI | InChI=1S/C18H26N2O8/c1-23-15-11-13-14(12-16(15)24-2)20-18(28-10-8-26-6-4-22)17(19-13)27-9-7-25-5-3-21/h11-12,21-22H,3-10H2,1-2H3 |
| InChIKey | KNXCRZYRXWYONI-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 121.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|