C24H34N2S — CID 156865135
1-(2,6-ditert-butylphenyl)-3-(2,4,6-trimethylphenyl)thiourea (PubChem CID 156865135) has the molecular formula C24H34N2S and a molecular weight of 382.62 g/mol. Its IUPAC name is 1-(2,6-ditert-butylphenyl)-3-(2,4,6-trimethylphenyl)thiourea.
| Compound Name | 1-(2,6-ditert-butylphenyl)-3-(2,4,6-trimethylphenyl)thiourea |
|---|---|
| PubChem CID | 156865135 |
| Molecular Formula | C24H34N2S |
| Molecular Weight | 382.62 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | 1-(2,6-ditert-butylphenyl)-3-(2,4,6-trimethylphenyl)thiourea |
| SMILES | Cc1cc(C)c(NC(=S)Nc2c(C(C)(C)C)cccc2C(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C24H34N2S/c1-15-13-16(2)20(17(3)14-15)25-22(27)26-21-18(23(4,5)6)11-10-12-19(21)24(7,8)9/h10-14H,1-9H3,(H2,25,26,27) |
| InChIKey | ORWZGZRYGFMTTP-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.62 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|