C14H13FmIrN3O2S-2 — CID 156868920
fermium;iridium;[4-(oxomethylamino)-4-(4-phenyl-1,3-thiazol-2-yl)butanoyl]azanide (PubChem CID 156868920) has the molecular formula C14H13FmIrN3O2S-2 and a molecular weight of 736.56 g/mol. Its IUPAC name is fermium;iridium;[4-(oxomethylamino)-4-(4-phenyl-1,3-thiazol-2-yl)butanoyl]azanide.
| Compound Name | fermium;iridium;[4-(oxomethylamino)-4-(4-phenyl-1,3-thiazol-2-yl)butanoyl]azanide |
|---|---|
| PubChem CID | 156868920 |
| Molecular Formula | C14H13FmIrN3O2S-2 |
| Molecular Weight | 736.56 g/mol |
| Exact Mass | 737.13 |
| IUPAC Name | fermium;iridium;[4-(oxomethylamino)-4-(4-phenyl-1,3-thiazol-2-yl)butanoyl]azanide |
| SMILES | [Fm].[Ir].[NH-]C(=O)CCC(N[C-]=O)c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C14H14N3O2S.Fm.Ir/c15-13(19)7-6-11(16-9-18)14-17-12(8-20-14)10-4-2-1-3-5-10;;/h1-5,8,11H,6-7H2,(H3,15,16,18,19);;/q-1;;/p-1 |
| InChIKey | JWNIJYAZXPAKHS-UHFFFAOYSA-M |
| XLogP | 2.86 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.56 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|