C18H20ClN3O2 — CID 156874853
ethyl 6-[(7-chloroquinolin-4-yl)amino]-2-cyanohexanoate (PubChem CID 156874853) has the molecular formula C18H20ClN3O2 and a molecular weight of 345.83 g/mol. Its IUPAC name is ethyl 6-[(7-chloroquinolin-4-yl)amino]-2-cyanohexanoate.
| Compound Name | ethyl 6-[(7-chloroquinolin-4-yl)amino]-2-cyanohexanoate |
|---|---|
| PubChem CID | 156874853 |
| Molecular Formula | C18H20ClN3O2 |
| Molecular Weight | 345.83 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | ethyl 6-[(7-chloroquinolin-4-yl)amino]-2-cyanohexanoate |
| SMILES | CCOC(=O)C(C#N)CCCCNc1ccnc2cc(Cl)ccc12 |
| InChI | InChI=1S/C18H20ClN3O2/c1-2-24-18(23)13(12-20)5-3-4-9-21-16-8-10-22-17-11-14(19)6-7-15(16)17/h6-8,10-11,13H,2-5,9H2,1H3,(H,21,22) |
| InChIKey | HGVXCASHJZRADA-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.83 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|