C27H30N2O6 — CID 156876585
6-[1-[2-(4,4-dimethylpiperidin-1-yl)-6-methyl-4-oxochromen-8-yl]ethylamino]-1,3-benzodioxole-5-carboxylic acid (PubChem CID 156876585) has the molecular formula C27H30N2O6 and a molecular weight of 478.55 g/mol. Its IUPAC name is 6-[1-[2-(4,4-dimethylpiperidin-1-yl)-6-methyl-4-oxochromen-8-yl]ethylamino]-1,3-benzodioxole-5-carboxylic acid.
| Compound Name | 6-[1-[2-(4,4-dimethylpiperidin-1-yl)-6-methyl-4-oxochromen-8-yl]ethylamino]-1,3-benzodioxole-5-carboxylic acid |
|---|---|
| PubChem CID | 156876585 |
| Molecular Formula | C27H30N2O6 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | 6-[1-[2-(4,4-dimethylpiperidin-1-yl)-6-methyl-4-oxochromen-8-yl]ethylamino]-1,3-benzodioxole-5-carboxylic acid |
| SMILES | Cc1cc(C(C)Nc2cc3c(cc2C(=O)O)OCO3)c2oc(N3CCC(C)(C)CC3)cc(=O)c2c1 |
| InChI | InChI=1S/C27H30N2O6/c1-15-9-17(16(2)28-20-12-23-22(33-14-34-23)11-18(20)26(31)32)25-19(10-15)21(30)13-24(35-25)29-7-5-27(3,4)6-8-29/h9-13,16,28H,5-8,14H2,1-4H3,(H,31,32) |
| InChIKey | QMZDSVQRDIQEFU-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 101.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|