C11H9N5O2 — CID 156876798
2-(13-amino-3,8,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-8-yl)acetic acid (PubChem CID 156876798) has the molecular formula C11H9N5O2 and a molecular weight of 243.23 g/mol. Its IUPAC name is 2-(13-amino-3,8,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-8-yl)acetic acid.
| Compound Name | 2-(13-amino-3,8,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-8-yl)acetic acid |
|---|---|
| PubChem CID | 156876798 |
| Molecular Formula | C11H9N5O2 |
| Molecular Weight | 243.23 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | 2-(13-amino-3,8,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-8-yl)acetic acid |
| SMILES | Nc1ncnc2c1c1ncccc1n2CC(=O)O |
| InChI | InChI=1S/C11H9N5O2/c12-10-8-9-6(2-1-3-13-9)16(4-7(17)18)11(8)15-5-14-10/h1-3,5H,4H2,(H,17,18)(H2,12,14,15) |
| InChIKey | PFRBKISLKMFLHY-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.23 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |