C23H26ClF2NO3 — CID 156878683
6-chloro-1-(3,4-difluorophenyl)-4-(methoxymethoxy)-2-(oxan-4-yl)indole;ethane (PubChem CID 156878683) has the molecular formula C23H26ClF2NO3 and a molecular weight of 437.91 g/mol. Its IUPAC name is 6-chloro-1-(3,4-difluorophenyl)-4-(methoxymethoxy)-2-(oxan-4-yl)indole;ethane.
| Compound Name | 6-chloro-1-(3,4-difluorophenyl)-4-(methoxymethoxy)-2-(oxan-4-yl)indole;ethane |
|---|---|
| PubChem CID | 156878683 |
| Molecular Formula | C23H26ClF2NO3 |
| Molecular Weight | 437.91 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | 6-chloro-1-(3,4-difluorophenyl)-4-(methoxymethoxy)-2-(oxan-4-yl)indole;ethane |
| SMILES | CC.COCOc1cc(Cl)cc2c1cc(C1CCOCC1)n2-c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C21H20ClF2NO3.C2H6/c1-26-12-28-21-9-14(22)8-20-16(21)11-19(13-4-6-27-7-5-13)25(20)15-2-3-17(23)18(24)10-15;1-2/h2-3,8-11,13H,4-7,12H2,1H3;1-2H3 |
| InChIKey | OSPFJGLSBKNDBJ-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 32.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.91 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|