C27H25FN2O4S — CID 156879221
4-[1-(4-fluorophenyl)-4-hydroxy-2-(oxan-4-yl)indol-3-yl]-N-methylsulfinylbenzamide (PubChem CID 156879221) has the molecular formula C27H25FN2O4S and a molecular weight of 492.57 g/mol. Its IUPAC name is 4-[1-(4-fluorophenyl)-4-hydroxy-2-(oxan-4-yl)indol-3-yl]-N-methylsulfinylbenzamide.
| Compound Name | 4-[1-(4-fluorophenyl)-4-hydroxy-2-(oxan-4-yl)indol-3-yl]-N-methylsulfinylbenzamide |
|---|---|
| PubChem CID | 156879221 |
| Molecular Formula | C27H25FN2O4S |
| Molecular Weight | 492.57 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | 4-[1-(4-fluorophenyl)-4-hydroxy-2-(oxan-4-yl)indol-3-yl]-N-methylsulfinylbenzamide |
| SMILES | CS(=O)NC(=O)c1ccc(-c2c(C3CCOCC3)n(-c3ccc(F)cc3)c3cccc(O)c23)cc1 |
| InChI | InChI=1S/C27H25FN2O4S/c1-35(33)29-27(32)19-7-5-17(6-8-19)24-25-22(3-2-4-23(25)31)30(21-11-9-20(28)10-12-21)26(24)18-13-15-34-16-14-18/h2-12,18,31H,13-16H2,1H3,(H,29,32) |
| InChIKey | QUZZHVHOGNUTFH-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.57 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |