C38H53N7O5 — CID 156882462
4-[[2-formyl-6-[4-[2-[methyl-[4-(triazol-1-yl)cyclohexyl]amino]ethoxy]but-1-ynyl]phenyl]methyl-methylamino]-N-methyl-5-oxopentanamide;2-methoxy-4-methylaniline (PubChem CID 156882462) has the molecular formula C38H53N7O5 and a molecular weight of 687.89 g/mol. Its IUPAC name is 4-[[2-formyl-6-[4-[2-[methyl-[4-(triazol-1-yl)cyclohexyl]amino]ethoxy]but-1-ynyl]phenyl]methyl-methylamino]-N-methyl-5-oxopentanamide;2-methoxy-4-methylaniline.
| Compound Name | 4-[[2-formyl-6-[4-[2-[methyl-[4-(triazol-1-yl)cyclohexyl]amino]ethoxy]but-1-ynyl]phenyl]methyl-methylamino]-N-methyl-5-oxopentanamide;2-methoxy-4-methylaniline |
|---|---|
| PubChem CID | 156882462 |
| Molecular Formula | C38H53N7O5 |
| Molecular Weight | 687.89 g/mol |
| Exact Mass | 687.41 |
| IUPAC Name | 4-[[2-formyl-6-[4-[2-[methyl-[4-(triazol-1-yl)cyclohexyl]amino]ethoxy]but-1-ynyl]phenyl]methyl-methylamino]-N-methyl-5-oxopentanamide;2-methoxy-4-methylaniline |
| SMILES | CNC(=O)CCC(C=O)N(C)Cc1c(C#CCCOCCN(C)C2CCC(n3ccnn3)CC2)cccc1C=O.COc1cc(C)ccc1N |
| InChI | InChI=1S/C30H42N6O4.C8H11NO/c1-31-30(39)15-14-28(23-38)35(3)21-29-24(8-6-9-25(29)22-37)7-4-5-19-40-20-18-34(2)26-10-12-27(13-11-26)36-17-16-32-33-36;1-6-3-4-7(9)8(5-6)10-2/h6,8-9,16-17,22-23,26-28H,5,10-15,18-21H2,1-3H3,(H,31,39);3-5H,9H2,1-2H3 |
| InChIKey | QTZMMSLWFQLEJQ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 144.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.89 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|