C27H30FN5O4S — CID 178055780
[[4-[[2-formyl-6-[2-[1-(5-formylpyrazin-2-yl)piperidin-4-yl]ethynyl]phenyl]methyl-methylamino]-5-oxopentanoyl]-methylamino] thiohypofluorite (PubChem CID 178055780) has the molecular formula C27H30FN5O4S and a molecular weight of 539.63 g/mol. Its IUPAC name is [[4-[[2-formyl-6-[2-[1-(5-formylpyrazin-2-yl)piperidin-4-yl]ethynyl]phenyl]methyl-methylamino]-5-oxopentanoyl]-methylamino] thiohypofluorite.
| Compound Name | [[4-[[2-formyl-6-[2-[1-(5-formylpyrazin-2-yl)piperidin-4-yl]ethynyl]phenyl]methyl-methylamino]-5-oxopentanoyl]-methylamino] thiohypofluorite |
|---|---|
| PubChem CID | 178055780 |
| Molecular Formula | C27H30FN5O4S |
| Molecular Weight | 539.63 g/mol |
| Exact Mass | 539.20 |
| IUPAC Name | [[4-[[2-formyl-6-[2-[1-(5-formylpyrazin-2-yl)piperidin-4-yl]ethynyl]phenyl]methyl-methylamino]-5-oxopentanoyl]-methylamino] thiohypofluorite |
| SMILES | CN(SF)C(=O)CCC(C=O)N(C)Cc1c(C#CC2CCN(c3cnc(C=O)cn3)CC2)cccc1C=O |
| InChI | InChI=1S/C27H30FN5O4S/c1-31(24(19-36)8-9-27(37)32(2)38-28)16-25-21(4-3-5-22(25)17-34)7-6-20-10-12-33(13-11-20)26-15-29-23(18-35)14-30-26/h3-5,14-15,17-20,24H,8-13,16H2,1-2H3 |
| InChIKey | JDAVRWJMEVRKMP-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 103.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.63 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|