C37H55N5O4S2 — CID 156883953
N-[4-cyano-3-oxo-1-(2-oxo-1-azaspiro[4.5]decan-3-yl)-4-(thiolan-1-ylidene)butan-2-yl]-2-sulfanylacetamide;1H-indole-2-carboxamide;3-methylheptane (PubChem CID 156883953) has the molecular formula C37H55N5O4S2 and a molecular weight of 698.01 g/mol. Its IUPAC name is N-[4-cyano-3-oxo-1-(2-oxo-1-azaspiro[4.5]decan-3-yl)-4-(thiolan-1-ylidene)butan-2-yl]-2-sulfanylacetamide;1H-indole-2-carboxamide;3-methylheptane.
| Compound Name | N-[4-cyano-3-oxo-1-(2-oxo-1-azaspiro[4.5]decan-3-yl)-4-(thiolan-1-ylidene)butan-2-yl]-2-sulfanylacetamide;1H-indole-2-carboxamide;3-methylheptane |
|---|---|
| PubChem CID | 156883953 |
| Molecular Formula | C37H55N5O4S2 |
| Molecular Weight | 698.01 g/mol |
| Exact Mass | 697.37 |
| IUPAC Name | N-[4-cyano-3-oxo-1-(2-oxo-1-azaspiro[4.5]decan-3-yl)-4-(thiolan-1-ylidene)butan-2-yl]-2-sulfanylacetamide;1H-indole-2-carboxamide;3-methylheptane |
| SMILES | CCCCC(C)CC.N#CC(C(=O)C(CC1CC2(CCCCC2)NC1=O)NC(=O)CS)=S1CCCC1.NC(=O)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C20H29N3O3S2.C9H8N2O.C8H18/c21-12-16(28-8-4-5-9-28)18(25)15(22-17(24)13-27)10-14-11-20(23-19(14)26)6-2-1-3-7-20;10-9(12)8-5-6-3-1-2-4-7(6)11-8;1-4-6-7-8(3)5-2/h14-15,27H,1-11,13H2,(H,22,24)(H,23,26);1-5,11H,(H2,10,12);8H,4-7H2,1-3H3 |
| InChIKey | WTGUNNHDMRFOQR-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 157.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.01 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|