C31H48N2O7 — CID 156886402
acetaldehyde;tert-butyl 1-[2-[3-methyl-4-(2-methylpropanoyl)phenoxy]ethyl]piperidine-4-carboxylate;3-methylpiperidine-2,6-dione (PubChem CID 156886402) has the molecular formula C31H48N2O7 and a molecular weight of 560.73 g/mol. Its IUPAC name is acetaldehyde;tert-butyl 1-[2-[3-methyl-4-(2-methylpropanoyl)phenoxy]ethyl]piperidine-4-carboxylate;3-methylpiperidine-2,6-dione.
| Compound Name | acetaldehyde;tert-butyl 1-[2-[3-methyl-4-(2-methylpropanoyl)phenoxy]ethyl]piperidine-4-carboxylate;3-methylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 156886402 |
| Molecular Formula | C31H48N2O7 |
| Molecular Weight | 560.73 g/mol |
| Exact Mass | 560.35 |
| IUPAC Name | acetaldehyde;tert-butyl 1-[2-[3-methyl-4-(2-methylpropanoyl)phenoxy]ethyl]piperidine-4-carboxylate;3-methylpiperidine-2,6-dione |
| SMILES | CC1CCC(=O)NC1=O.CC=O.Cc1cc(OCCN2CCC(C(=O)OC(C)(C)C)CC2)ccc1C(=O)C(C)C |
| InChI | InChI=1S/C23H35NO4.C6H9NO2.C2H4O/c1-16(2)21(25)20-8-7-19(15-17(20)3)27-14-13-24-11-9-18(10-12-24)22(26)28-23(4,5)6;1-4-2-3-5(8)7-6(4)9;1-2-3/h7-8,15-16,18H,9-14H2,1-6H3;4H,2-3H2,1H3,(H,7,8,9);2H,1H3 |
| InChIKey | VIRSJRJAFUIENJ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.73 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|