C16H26N4O5 — CID 156887245
(2S)-2-[(2-acetamidoacetyl)amino]-N-[3-(cyclopropylamino)-2,3-dioxopropyl]-4-methylpentanamide (PubChem CID 156887245) has the molecular formula C16H26N4O5 and a molecular weight of 354.41 g/mol. Its IUPAC name is (2S)-2-[(2-acetamidoacetyl)amino]-N-[3-(cyclopropylamino)-2,3-dioxopropyl]-4-methylpentanamide.
| Compound Name | (2S)-2-[(2-acetamidoacetyl)amino]-N-[3-(cyclopropylamino)-2,3-dioxopropyl]-4-methylpentanamide |
|---|---|
| PubChem CID | 156887245 |
| Molecular Formula | C16H26N4O5 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | (2S)-2-[(2-acetamidoacetyl)amino]-N-[3-(cyclopropylamino)-2,3-dioxopropyl]-4-methylpentanamide |
| SMILES | CC(=O)NCC(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)C(=O)NC1CC1 |
| InChI | InChI=1S/C16H26N4O5/c1-9(2)6-12(20-14(23)8-17-10(3)21)15(24)18-7-13(22)16(25)19-11-4-5-11/h9,11-12H,4-8H2,1-3H3,(H,17,21)(H,18,24)(H,19,25)(H,20,23)/t12-/m0/s1 |
| InChIKey | QJPMOFOBOBXENM-LBPRGKRZSA-N |
| XLogP | -1.38 |
| TPSA | 133.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|