C24H23F3N8O3 — CID 156887488
[3-hydroxy-2-[3-[(3S)-3-propan-2-ylpiperazin-1-yl]-1,2,4-triazin-6-yl]-5-pyrazolo[1,5-a]pyrimidin-3-ylphenyl] 2,2,2-trifluoroacetate (PubChem CID 156887488) has the molecular formula C24H23F3N8O3 and a molecular weight of 528.50 g/mol. Its IUPAC name is [3-hydroxy-2-[3-[(3S)-3-propan-2-ylpiperazin-1-yl]-1,2,4-triazin-6-yl]-5-pyrazolo[1,5-a]pyrimidin-3-ylphenyl] 2,2,2-trifluoroacetate.
| Compound Name | [3-hydroxy-2-[3-[(3S)-3-propan-2-ylpiperazin-1-yl]-1,2,4-triazin-6-yl]-5-pyrazolo[1,5-a]pyrimidin-3-ylphenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 156887488 |
| Molecular Formula | C24H23F3N8O3 |
| Molecular Weight | 528.50 g/mol |
| Exact Mass | 528.18 |
| IUPAC Name | [3-hydroxy-2-[3-[(3S)-3-propan-2-ylpiperazin-1-yl]-1,2,4-triazin-6-yl]-5-pyrazolo[1,5-a]pyrimidin-3-ylphenyl] 2,2,2-trifluoroacetate |
| SMILES | CC(C)[C@H]1CN(c2ncc(-c3c(O)cc(-c4cnn5cccnc45)cc3OC(=O)C(F)(F)F)nn2)CCN1 |
| InChI | InChI=1S/C24H23F3N8O3/c1-13(2)17-12-34(7-5-28-17)23-30-11-16(32-33-23)20-18(36)8-14(9-19(20)38-22(37)24(25,26)27)15-10-31-35-6-3-4-29-21(15)35/h3-4,6,8-11,13,17,28,36H,5,7,12H2,1-2H3/t17-/m1/s1 |
| InChIKey | QYCFCOZSGPRXKR-QGZVFWFLSA-N |
| XLogP | 2.86 |
| TPSA | 130.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.50 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|