C17H23ClN6O2 — CID 155287279
6-[5-chloro-3-(methoxymethoxy)-2-pyridinyl]-3-[(3S)-3-propan-2-ylpiperazin-1-yl]-1,2,4-triazine (PubChem CID 155287279) has the molecular formula C17H23ClN6O2 and a molecular weight of 378.86 g/mol. Its IUPAC name is 6-[5-chloro-3-(methoxymethoxy)-2-pyridinyl]-3-[(3S)-3-propan-2-ylpiperazin-1-yl]-1,2,4-triazine.
| Compound Name | 6-[5-chloro-3-(methoxymethoxy)-2-pyridinyl]-3-[(3S)-3-propan-2-ylpiperazin-1-yl]-1,2,4-triazine |
|---|---|
| PubChem CID | 155287279 |
| Molecular Formula | C17H23ClN6O2 |
| Molecular Weight | 378.86 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 6-[5-chloro-3-(methoxymethoxy)-2-pyridinyl]-3-[(3S)-3-propan-2-ylpiperazin-1-yl]-1,2,4-triazine |
| SMILES | COCOc1cc(Cl)cnc1-c1cnc(N2CCN[C@@H](C(C)C)C2)nn1 |
| InChI | InChI=1S/C17H23ClN6O2/c1-11(2)14-9-24(5-4-19-14)17-21-8-13(22-23-17)16-15(26-10-25-3)6-12(18)7-20-16/h6-8,11,14,19H,4-5,9-10H2,1-3H3/t14-/m1/s1 |
| InChIKey | CEXXOFCPYYKDRF-CQSZACIVSA-N |
| XLogP | 2.00 |
| TPSA | 85.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.86 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|