C24H22F3N7O2S — CID 167441422
[2-[3-[(3S)-3-propan-2-ylpiperazin-1-yl]-1,2,4-triazin-6-yl]-5-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl] 2,2,2-trifluoroacetate (PubChem CID 167441422) has the molecular formula C24H22F3N7O2S and a molecular weight of 529.55 g/mol. Its IUPAC name is [2-[3-[(3S)-3-propan-2-ylpiperazin-1-yl]-1,2,4-triazin-6-yl]-5-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl] 2,2,2-trifluoroacetate.
| Compound Name | [2-[3-[(3S)-3-propan-2-ylpiperazin-1-yl]-1,2,4-triazin-6-yl]-5-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 167441422 |
| Molecular Formula | C24H22F3N7O2S |
| Molecular Weight | 529.55 g/mol |
| Exact Mass | 529.15 |
| IUPAC Name | [2-[3-[(3S)-3-propan-2-ylpiperazin-1-yl]-1,2,4-triazin-6-yl]-5-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl] 2,2,2-trifluoroacetate |
| SMILES | CC(C)[C@H]1CN(c2ncc(-c3ccc(-c4nc5cccnc5s4)cc3OC(=O)C(F)(F)F)nn2)CCN1 |
| InChI | InChI=1S/C24H22F3N7O2S/c1-13(2)18-12-34(9-8-28-18)23-30-11-17(32-33-23)15-6-5-14(10-19(15)36-22(35)24(25,26)27)20-31-16-4-3-7-29-21(16)37-20/h3-7,10-11,13,18,28H,8-9,12H2,1-2H3/t18-/m1/s1 |
| InChIKey | UFLKUWCUICAAIU-GOSISDBHSA-N |
| XLogP | 4.11 |
| TPSA | 106.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.55 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|