C20H23N7O2S — CID 167441394
3-[4-[3-[(3S)-3-cyclopropylpiperazin-1-yl]-1,2,4-triazin-6-yl]-3-(methoxymethoxy)phenyl]-1,2,4-thiadiazole (PubChem CID 167441394) has the molecular formula C20H23N7O2S and a molecular weight of 425.52 g/mol. Its IUPAC name is 3-[4-[3-[(3S)-3-cyclopropylpiperazin-1-yl]-1,2,4-triazin-6-yl]-3-(methoxymethoxy)phenyl]-1,2,4-thiadiazole.
| Compound Name | 3-[4-[3-[(3S)-3-cyclopropylpiperazin-1-yl]-1,2,4-triazin-6-yl]-3-(methoxymethoxy)phenyl]-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 167441394 |
| Molecular Formula | C20H23N7O2S |
| Molecular Weight | 425.52 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | 3-[4-[3-[(3S)-3-cyclopropylpiperazin-1-yl]-1,2,4-triazin-6-yl]-3-(methoxymethoxy)phenyl]-1,2,4-thiadiazole |
| SMILES | COCOc1cc(-c2ncsn2)ccc1-c1cnc(N2CCN[C@@H](C3CC3)C2)nn1 |
| InChI | InChI=1S/C20H23N7O2S/c1-28-12-29-18-8-14(19-23-11-30-26-19)4-5-15(18)16-9-22-20(25-24-16)27-7-6-21-17(10-27)13-2-3-13/h4-5,8-9,11,13,17,21H,2-3,6-7,10,12H2,1H3/t17-/m1/s1 |
| InChIKey | PTQMCAISQSYRNM-QGZVFWFLSA-N |
| XLogP | 2.23 |
| TPSA | 98.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.52 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|