C24H20BN5O — CID 156889303
3-[3-(2-methylindazol-5-yl)-4-oxoquinazolin-7-yl]-8-borabicyclo[3.2.1]oct-2-ene-8-carbonitrile (PubChem CID 156889303) has the molecular formula C24H20BN5O and a molecular weight of 405.27 g/mol. Its IUPAC name is 3-[3-(2-methylindazol-5-yl)-4-oxoquinazolin-7-yl]-8-borabicyclo[3.2.1]oct-2-ene-8-carbonitrile.
| Compound Name | 3-[3-(2-methylindazol-5-yl)-4-oxoquinazolin-7-yl]-8-borabicyclo[3.2.1]oct-2-ene-8-carbonitrile |
|---|---|
| PubChem CID | 156889303 |
| Molecular Formula | C24H20BN5O |
| Molecular Weight | 405.27 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | 3-[3-(2-methylindazol-5-yl)-4-oxoquinazolin-7-yl]-8-borabicyclo[3.2.1]oct-2-ene-8-carbonitrile |
| SMILES | Cn1cc2cc(-n3cnc4cc(C5=CC6CCC(C5)B6C#N)ccc4c3=O)ccc2n1 |
| InChI | InChI=1S/C24H20BN5O/c1-29-12-17-10-20(5-7-22(17)28-29)30-14-27-23-11-15(2-6-21(23)24(30)31)16-8-18-3-4-19(9-16)25(18)13-26/h2,5-8,10-12,14,18-19H,3-4,9H2,1H3 |
| InChIKey | DEJQJJRVECTMHG-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 76.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.27 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|