C10H17F2NO2 — CID 156890040
1-[1-amino-4-(2,2-difluoroethoxy)cyclohexyl]ethenol (PubChem CID 156890040) has the molecular formula C10H17F2NO2 and a molecular weight of 221.25 g/mol. Its IUPAC name is 1-[1-amino-4-(2,2-difluoroethoxy)cyclohexyl]ethenol.
| Compound Name | 1-[1-amino-4-(2,2-difluoroethoxy)cyclohexyl]ethenol |
|---|---|
| PubChem CID | 156890040 |
| Molecular Formula | C10H17F2NO2 |
| Molecular Weight | 221.25 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 1-[1-amino-4-(2,2-difluoroethoxy)cyclohexyl]ethenol |
| SMILES | C=C(O)C1(N)CCC(OCC(F)F)CC1 |
| InChI | InChI=1S/C10H17F2NO2/c1-7(14)10(13)4-2-8(3-5-10)15-6-9(11)12/h8-9,14H,1-6,13H2 |
| InChIKey | FXWFJLKPKDIOST-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.25 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|