C23H33FN2O6 — CID 156903577
[(1S,3S,5S)-5-(2,2-dimethylpropanoyloxy)-1-(fluoromethyl)-3-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-methylidenecyclopentyl]methyl 2,2-dimethylpropanoate (PubChem CID 156903577) has the molecular formula C23H33FN2O6 and a molecular weight of 452.52 g/mol. Its IUPAC name is [(1S,3S,5S)-5-(2,2-dimethylpropanoyloxy)-1-(fluoromethyl)-3-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-methylidenecyclopentyl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(1S,3S,5S)-5-(2,2-dimethylpropanoyloxy)-1-(fluoromethyl)-3-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-methylidenecyclopentyl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 156903577 |
| Molecular Formula | C23H33FN2O6 |
| Molecular Weight | 452.52 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | [(1S,3S,5S)-5-(2,2-dimethylpropanoyloxy)-1-(fluoromethyl)-3-(5-methyl-2,4-dioxopyrimidin-1-yl)-2-methylidenecyclopentyl]methyl 2,2-dimethylpropanoate |
| SMILES | C=C1[C@@H](n2cc(C)c(=O)[nH]c2=O)C[C@H](OC(=O)C(C)(C)C)[C@@]1(CF)COC(=O)C(C)(C)C |
| InChI | InChI=1S/C23H33FN2O6/c1-13-10-26(20(30)25-17(13)27)15-9-16(32-19(29)22(6,7)8)23(11-24,14(15)2)12-31-18(28)21(3,4)5/h10,15-16H,2,9,11-12H2,1,3-8H3,(H,25,27,30)/t15-,16-,23-/m0/s1 |
| InChIKey | NYXFAHHECGBORL-KXNSMUHISA-N |
| XLogP | 2.85 |
| TPSA | 107.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.52 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|