C39H38O4 — CID 156903596
(1R,2S,5S)-2-phenylmethoxy-1-(phenylmethoxymethyl)-5-trityloxycyclopentan-1-ol (PubChem CID 156903596) has the molecular formula C39H38O4 and a molecular weight of 570.73 g/mol. Its IUPAC name is (1R,2S,5S)-2-phenylmethoxy-1-(phenylmethoxymethyl)-5-trityloxycyclopentan-1-ol.
| Compound Name | (1R,2S,5S)-2-phenylmethoxy-1-(phenylmethoxymethyl)-5-trityloxycyclopentan-1-ol |
|---|---|
| PubChem CID | 156903596 |
| Molecular Formula | C39H38O4 |
| Molecular Weight | 570.73 g/mol |
| Exact Mass | 570.28 |
| IUPAC Name | (1R,2S,5S)-2-phenylmethoxy-1-(phenylmethoxymethyl)-5-trityloxycyclopentan-1-ol |
| SMILES | O[C@]1(COCc2ccccc2)[C@@H](OCc2ccccc2)CC[C@@H]1OC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C39H38O4/c40-38(30-41-28-31-16-6-1-7-17-31)36(42-29-32-18-8-2-9-19-32)26-27-37(38)43-39(33-20-10-3-11-21-33,34-22-12-4-13-23-34)35-24-14-5-15-25-35/h1-25,36-37,40H,26-30H2/t36-,37-,38+/m0/s1 |
| InChIKey | VWEHXWFTYFLMOK-XEZIGOATSA-N |
| XLogP | 7.69 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.73 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|