C34H36O5 — CID 15868442
(1R,2R,4R)-1-(hydroxymethyl)-4-[(4-methoxyphenyl)-diphenylmethoxy]-2-(phenylmethoxymethyl)cyclopentan-1-ol (PubChem CID 15868442) has the molecular formula C34H36O5 and a molecular weight of 524.66 g/mol. Its IUPAC name is (1R,2R,4R)-1-(hydroxymethyl)-4-[(4-methoxyphenyl)-diphenylmethoxy]-2-(phenylmethoxymethyl)cyclopentan-1-ol.
| Compound Name | (1R,2R,4R)-1-(hydroxymethyl)-4-[(4-methoxyphenyl)-diphenylmethoxy]-2-(phenylmethoxymethyl)cyclopentan-1-ol |
|---|---|
| PubChem CID | 15868442 |
| Molecular Formula | C34H36O5 |
| Molecular Weight | 524.66 g/mol |
| Exact Mass | 524.26 |
| IUPAC Name | (1R,2R,4R)-1-(hydroxymethyl)-4-[(4-methoxyphenyl)-diphenylmethoxy]-2-(phenylmethoxymethyl)cyclopentan-1-ol |
| SMILES | COc1ccc(C(O[C@@H]2C[C@H](COCc3ccccc3)[C@@](O)(CO)C2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C34H36O5/c1-37-31-19-17-29(18-20-31)34(27-13-7-3-8-14-27,28-15-9-4-10-16-28)39-32-21-30(33(36,22-32)25-35)24-38-23-26-11-5-2-6-12-26/h2-20,30,32,35-36H,21-25H2,1H3/t30-,32-,33+/m1/s1 |
| InChIKey | ASDGISYJNQLGOF-QYAQUCTESA-N |
| XLogP | 5.72 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.66 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|