C30H24N4O4 — CID 156904374
methyl 3-[3-amino-5-[(1,3-diphenylpyrazole-4-carbonyl)amino]phenoxy]benzoate (PubChem CID 156904374) has the molecular formula C30H24N4O4 and a molecular weight of 504.55 g/mol. Its IUPAC name is methyl 3-[3-amino-5-[(1,3-diphenylpyrazole-4-carbonyl)amino]phenoxy]benzoate.
| Compound Name | methyl 3-[3-amino-5-[(1,3-diphenylpyrazole-4-carbonyl)amino]phenoxy]benzoate |
|---|---|
| PubChem CID | 156904374 |
| Molecular Formula | C30H24N4O4 |
| Molecular Weight | 504.55 g/mol |
| Exact Mass | 504.18 |
| IUPAC Name | methyl 3-[3-amino-5-[(1,3-diphenylpyrazole-4-carbonyl)amino]phenoxy]benzoate |
| SMILES | COC(=O)c1cccc(Oc2cc(N)cc(NC(=O)c3cn(-c4ccccc4)nc3-c3ccccc3)c2)c1 |
| InChI | InChI=1S/C30H24N4O4/c1-37-30(36)21-11-8-14-25(15-21)38-26-17-22(31)16-23(18-26)32-29(35)27-19-34(24-12-6-3-7-13-24)33-28(27)20-9-4-2-5-10-20/h2-19H,31H2,1H3,(H,32,35) |
| InChIKey | ZHNQLGVWULLMSA-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.55 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|