C17H21N5O2S2 — CID 156905915
(1S,2R,3S)-3-ethyl-5-[[2-[(3-methyl-1,2-thiazol-5-yl)amino]thieno[3,2-d]pyrimidin-4-yl]amino]cyclopentane-1,2-diol (PubChem CID 156905915) has the molecular formula C17H21N5O2S2 and a molecular weight of 391.52 g/mol. Its IUPAC name is (1S,2R,3S)-3-ethyl-5-[[2-[(3-methyl-1,2-thiazol-5-yl)amino]thieno[3,2-d]pyrimidin-4-yl]amino]cyclopentane-1,2-diol.
| Compound Name | (1S,2R,3S)-3-ethyl-5-[[2-[(3-methyl-1,2-thiazol-5-yl)amino]thieno[3,2-d]pyrimidin-4-yl]amino]cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 156905915 |
| Molecular Formula | C17H21N5O2S2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | (1S,2R,3S)-3-ethyl-5-[[2-[(3-methyl-1,2-thiazol-5-yl)amino]thieno[3,2-d]pyrimidin-4-yl]amino]cyclopentane-1,2-diol |
| SMILES | CC[C@H]1CC(Nc2nc(Nc3cc(C)ns3)nc3ccsc23)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H21N5O2S2/c1-3-9-7-11(14(24)13(9)23)18-16-15-10(4-5-25-15)19-17(21-16)20-12-6-8(2)22-26-12/h4-6,9,11,13-14,23-24H,3,7H2,1-2H3,(H2,18,19,20,21)/t9-,11?,13+,14-/m0/s1 |
| InChIKey | WPNMDTVOJOSBND-FEDSUXBHSA-N |
| XLogP | 3.13 |
| TPSA | 103.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |