C16H18IN5S2 — CID 145256377
4-N-(4-iodocyclohexyl)-2-N-(3-methyl-1,2-thiazol-5-yl)thieno[3,2-d]pyrimidine-2,4-diamine (PubChem CID 145256377) has the molecular formula C16H18IN5S2 and a molecular weight of 471.39 g/mol. Its IUPAC name is 4-N-(4-iodocyclohexyl)-2-N-(3-methyl-1,2-thiazol-5-yl)thieno[3,2-d]pyrimidine-2,4-diamine.
| Compound Name | 4-N-(4-iodocyclohexyl)-2-N-(3-methyl-1,2-thiazol-5-yl)thieno[3,2-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 145256377 |
| Molecular Formula | C16H18IN5S2 |
| Molecular Weight | 471.39 g/mol |
| Exact Mass | 471.00 |
| IUPAC Name | 4-N-(4-iodocyclohexyl)-2-N-(3-methyl-1,2-thiazol-5-yl)thieno[3,2-d]pyrimidine-2,4-diamine |
| SMILES | Cc1cc(Nc2nc(NC3CCC(I)CC3)c3sccc3n2)sn1 |
| InChI | InChI=1S/C16H18IN5S2/c1-9-8-13(24-22-9)20-16-19-12-6-7-23-14(12)15(21-16)18-11-4-2-10(17)3-5-11/h6-8,10-11H,2-5H2,1H3,(H2,18,19,20,21) |
| InChIKey | GOYDXASRHMPCFL-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.39 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|