C18H23N5O3S3 — CID 175184302
2-[4-[[2-[(3-methyl-1,2-thiazol-5-yl)amino]thieno[3,2-d]pyrimidin-4-yl]amino]cyclohexyl]ethanesulfonic acid (PubChem CID 175184302) has the molecular formula C18H23N5O3S3 and a molecular weight of 453.62 g/mol. Its IUPAC name is 2-[4-[[2-[(3-methyl-1,2-thiazol-5-yl)amino]thieno[3,2-d]pyrimidin-4-yl]amino]cyclohexyl]ethanesulfonic acid.
| Compound Name | 2-[4-[[2-[(3-methyl-1,2-thiazol-5-yl)amino]thieno[3,2-d]pyrimidin-4-yl]amino]cyclohexyl]ethanesulfonic acid |
|---|---|
| PubChem CID | 175184302 |
| Molecular Formula | C18H23N5O3S3 |
| Molecular Weight | 453.62 g/mol |
| Exact Mass | 453.10 |
| IUPAC Name | 2-[4-[[2-[(3-methyl-1,2-thiazol-5-yl)amino]thieno[3,2-d]pyrimidin-4-yl]amino]cyclohexyl]ethanesulfonic acid |
| SMILES | Cc1cc(Nc2nc(NC3CCC(CCS(=O)(=O)O)CC3)c3sccc3n2)sn1 |
| InChI | InChI=1S/C18H23N5O3S3/c1-11-10-15(28-23-11)21-18-20-14-6-8-27-16(14)17(22-18)19-13-4-2-12(3-5-13)7-9-29(24,25)26/h6,8,10,12-13H,2-5,7,9H2,1H3,(H,24,25,26)(H2,19,20,21,22) |
| InChIKey | PHNSBOHYTWQURC-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 117.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.62 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|