C25H44NO5+ — CID 156962405
[3-carboxy-2-[(9E,12E,15E)-17-hydroxyoctadeca-9,12,15-trienoyl]oxypropyl]-trimethylazanium (PubChem CID 156962405) has the molecular formula C25H44NO5+ and a molecular weight of 438.63 g/mol. Its IUPAC name is [3-carboxy-2-[(9E,12E,15E)-17-hydroxyoctadeca-9,12,15-trienoyl]oxypropyl]-trimethylazanium.
| Compound Name | [3-carboxy-2-[(9E,12E,15E)-17-hydroxyoctadeca-9,12,15-trienoyl]oxypropyl]-trimethylazanium |
|---|---|
| PubChem CID | 156962405 |
| Molecular Formula | C25H44NO5+ |
| Molecular Weight | 438.63 g/mol |
| Exact Mass | 438.32 |
| IUPAC Name | [3-carboxy-2-[(9E,12E,15E)-17-hydroxyoctadeca-9,12,15-trienoyl]oxypropyl]-trimethylazanium |
| SMILES | CC(O)/C=C/C/C=C/C/C=C/CCCCCCCC(=O)OC(CC(=O)O)C[N+](C)(C)C |
| InChI | InChI=1S/C25H43NO5/c1-22(27)18-16-14-12-10-8-6-5-7-9-11-13-15-17-19-25(30)31-23(20-24(28)29)21-26(2,3)4/h5-6,10,12,16,18,22-23,27H,7-9,11,13-15,17,19-21H2,1-4H3/p+1/b6-5+,12-10+,18-16+ |
| InChIKey | LMRYSCXZPRJPMO-AFAKWXAZSA-O |
| XLogP | 4.64 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.63 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|