C16H30NO5+ — CID 156962729
[3-carboxy-2-[(E)-6-hydroxynon-3-enoyl]oxypropyl]-trimethylazanium (PubChem CID 156962729) has the molecular formula C16H30NO5+ and a molecular weight of 316.42 g/mol. Its IUPAC name is [3-carboxy-2-[(E)-6-hydroxynon-3-enoyl]oxypropyl]-trimethylazanium.
| Compound Name | [3-carboxy-2-[(E)-6-hydroxynon-3-enoyl]oxypropyl]-trimethylazanium |
|---|---|
| PubChem CID | 156962729 |
| Molecular Formula | C16H30NO5+ |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.21 |
| IUPAC Name | [3-carboxy-2-[(E)-6-hydroxynon-3-enoyl]oxypropyl]-trimethylazanium |
| SMILES | CCCC(O)C/C=C/CC(=O)OC(CC(=O)O)C[N+](C)(C)C |
| InChI | InChI=1S/C16H29NO5/c1-5-8-13(18)9-6-7-10-16(21)22-14(11-15(19)20)12-17(2,3)4/h6-7,13-14,18H,5,8-12H2,1-4H3/p+1/b7-6+ |
| InChIKey | GVVWHMARXUIYDC-VOTSOKGWSA-O |
| XLogP | 1.58 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|