C15H26NO7+ — CID 156962657
[3-carboxy-2-[(E)-7-carboxy-6-hydroxyhept-3-enoyl]oxypropyl]-trimethylazanium (PubChem CID 156962657) has the molecular formula C15H26NO7+ and a molecular weight of 332.37 g/mol. Its IUPAC name is [3-carboxy-2-[(E)-7-carboxy-6-hydroxyhept-3-enoyl]oxypropyl]-trimethylazanium.
| Compound Name | [3-carboxy-2-[(E)-7-carboxy-6-hydroxyhept-3-enoyl]oxypropyl]-trimethylazanium |
|---|---|
| PubChem CID | 156962657 |
| Molecular Formula | C15H26NO7+ |
| Molecular Weight | 332.37 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | [3-carboxy-2-[(E)-7-carboxy-6-hydroxyhept-3-enoyl]oxypropyl]-trimethylazanium |
| SMILES | C[N+](C)(C)CC(CC(=O)O)OC(=O)C/C=C/CC(O)CC(=O)O |
| InChI | InChI=1S/C15H25NO7/c1-16(2,3)10-12(9-14(20)21)23-15(22)7-5-4-6-11(17)8-13(18)19/h4-5,11-12,17H,6-10H2,1-3H3,(H-,18,19,20,21)/p+1/b5-4+ |
| InChIKey | NKAGGIIZXFTAEV-SNAWJCMRSA-O |
| XLogP | 0.25 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.37 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|