C42H71O9P — CID 156967887
[(2R)-2-[(10Z,13Z)-nonadeca-10,13-dienoyl]oxy-3-phosphonooxypropyl] (5E,7Z,11Z,14Z)-9-hydroxyicosa-5,7,11,14-tetraenoate (PubChem CID 156967887) has the molecular formula C42H71O9P and a molecular weight of 751.00 g/mol. Its IUPAC name is [(2R)-2-[(10Z,13Z)-nonadeca-10,13-dienoyl]oxy-3-phosphonooxypropyl] (5E,7Z,11Z,14Z)-9-hydroxyicosa-5,7,11,14-tetraenoate.
| Compound Name | [(2R)-2-[(10Z,13Z)-nonadeca-10,13-dienoyl]oxy-3-phosphonooxypropyl] (5E,7Z,11Z,14Z)-9-hydroxyicosa-5,7,11,14-tetraenoate |
|---|---|
| PubChem CID | 156967887 |
| Molecular Formula | C42H71O9P |
| Molecular Weight | 751.00 g/mol |
| Exact Mass | 750.48 |
| IUPAC Name | [(2R)-2-[(10Z,13Z)-nonadeca-10,13-dienoyl]oxy-3-phosphonooxypropyl] (5E,7Z,11Z,14Z)-9-hydroxyicosa-5,7,11,14-tetraenoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(=O)O[C@H](COC(=O)CCC/C=C/C=C\C(O)C/C=C\C/C=C\CCCCC)COP(=O)(O)O |
| InChI | InChI=1S/C42H71O9P/c1-3-5-7-9-11-13-14-15-16-17-18-19-21-23-27-32-36-42(45)51-40(38-50-52(46,47)48)37-49-41(44)35-31-28-24-26-30-34-39(43)33-29-25-22-20-12-10-8-6-4-2/h11-13,15-16,20,24-26,29-30,34,39-40,43H,3-10,14,17-19,21-23,27-28,31-33,35-38H2,1-2H3,(H2,46,47,48)/b13-11-,16-15-,20-12-,26-24+,29-25-,34-30-/t39?,40-/m1/s1 |
| InChIKey | DUGNUYJKTPNRCG-NKENOZBGSA-N |
| XLogP | 10.87 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.00 |
| LogP ≤ 5 | 10.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|