C43H69O9P — CID 156968507
[(2R)-1-[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoyl]oxy-3-phosphonooxypropan-2-yl] (5E,8Z,11R,12Z,14Z)-11-hydroxyicosa-5,8,12,14-tetraenoate (PubChem CID 156968507) has the molecular formula C43H69O9P and a molecular weight of 760.99 g/mol. Its IUPAC name is [(2R)-1-[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoyl]oxy-3-phosphonooxypropan-2-yl] (5E,8Z,11R,12Z,14Z)-11-hydroxyicosa-5,8,12,14-tetraenoate.
| Compound Name | [(2R)-1-[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoyl]oxy-3-phosphonooxypropan-2-yl] (5E,8Z,11R,12Z,14Z)-11-hydroxyicosa-5,8,12,14-tetraenoate |
|---|---|
| PubChem CID | 156968507 |
| Molecular Formula | C43H69O9P |
| Molecular Weight | 760.99 g/mol |
| Exact Mass | 760.47 |
| IUPAC Name | [(2R)-1-[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoyl]oxy-3-phosphonooxypropan-2-yl] (5E,8Z,11R,12Z,14Z)-11-hydroxyicosa-5,8,12,14-tetraenoate |
| SMILES | CCCCC/C=C\C=C/[C@H](O)C/C=C\C/C=C/CCCC(=O)O[C@H](COC(=O)CCC/C=C\C/C=C\C/C=C\C/C=C\CCCCC)COP(=O)(O)O |
| InChI | InChI=1S/C43H69O9P/c1-3-5-7-9-11-12-13-14-15-16-17-18-19-20-24-28-32-36-42(45)50-38-41(39-51-53(47,48)49)52-43(46)37-33-29-25-21-23-27-31-35-40(44)34-30-26-22-10-8-6-4-2/h11-12,14-15,17-18,20-22,24-27,30-31,34,40-41,44H,3-10,13,16,19,23,28-29,32-33,35-39H2,1-2H3,(H2,47,48,49)/b12-11-,15-14-,18-17-,24-20-,25-21+,26-22-,31-27-,34-30-/t40-,41+/m0/s1 |
| InChIKey | BVNUZCVMAVENMX-SKAGHGCKSA-N |
| XLogP | 10.81 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.99 |
| LogP ≤ 5 | 10.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|