C31H53O9P — CID 156969960
[(2R)-2-octanoyloxy-3-phosphonooxypropyl] (5E,8Z,11S,12Z,14Z)-11-hydroxyicosa-5,8,12,14-tetraenoate (PubChem CID 156969960) has the molecular formula C31H53O9P and a molecular weight of 600.73 g/mol. Its IUPAC name is [(2R)-2-octanoyloxy-3-phosphonooxypropyl] (5E,8Z,11S,12Z,14Z)-11-hydroxyicosa-5,8,12,14-tetraenoate.
| Compound Name | [(2R)-2-octanoyloxy-3-phosphonooxypropyl] (5E,8Z,11S,12Z,14Z)-11-hydroxyicosa-5,8,12,14-tetraenoate |
|---|---|
| PubChem CID | 156969960 |
| Molecular Formula | C31H53O9P |
| Molecular Weight | 600.73 g/mol |
| Exact Mass | 600.34 |
| IUPAC Name | [(2R)-2-octanoyloxy-3-phosphonooxypropyl] (5E,8Z,11S,12Z,14Z)-11-hydroxyicosa-5,8,12,14-tetraenoate |
| SMILES | CCCCC/C=C\C=C/[C@@H](O)C/C=C\C/C=C/CCCC(=O)OC[C@H](COP(=O)(O)O)OC(=O)CCCCCCC |
| InChI | InChI=1S/C31H53O9P/c1-3-5-7-9-11-15-18-22-28(32)23-19-16-12-10-13-17-20-24-30(33)38-26-29(27-39-41(35,36)37)40-31(34)25-21-14-8-6-4-2/h10-11,13,15-16,18-19,22,28-29,32H,3-9,12,14,17,20-21,23-27H2,1-2H3,(H2,35,36,37)/b13-10+,15-11-,19-16-,22-18-/t28-,29-/m1/s1 |
| InChIKey | OBPQHZXJEHOESL-RBALJRNWSA-N |
| XLogP | 7.03 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.73 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|