C43H71O9P — CID 156968406
[(2R)-2-[(8Z,11Z,14Z)-icosa-8,11,14-trienoyl]oxy-3-phosphonooxypropyl] (5E,7Z,11Z,14Z)-9-hydroxyicosa-5,7,11,14-tetraenoate (PubChem CID 156968406) has the molecular formula C43H71O9P and a molecular weight of 763.01 g/mol. Its IUPAC name is [(2R)-2-[(8Z,11Z,14Z)-icosa-8,11,14-trienoyl]oxy-3-phosphonooxypropyl] (5E,7Z,11Z,14Z)-9-hydroxyicosa-5,7,11,14-tetraenoate.
| Compound Name | [(2R)-2-[(8Z,11Z,14Z)-icosa-8,11,14-trienoyl]oxy-3-phosphonooxypropyl] (5E,7Z,11Z,14Z)-9-hydroxyicosa-5,7,11,14-tetraenoate |
|---|---|
| PubChem CID | 156968406 |
| Molecular Formula | C43H71O9P |
| Molecular Weight | 763.01 g/mol |
| Exact Mass | 762.48 |
| IUPAC Name | [(2R)-2-[(8Z,11Z,14Z)-icosa-8,11,14-trienoyl]oxy-3-phosphonooxypropyl] (5E,7Z,11Z,14Z)-9-hydroxyicosa-5,7,11,14-tetraenoate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\CCCCCCC(=O)O[C@H](COC(=O)CCC/C=C/C=C\C(O)C/C=C\C/C=C\CCCCC)COP(=O)(O)O |
| InChI | InChI=1S/C43H71O9P/c1-3-5-7-9-11-13-14-15-16-17-18-19-20-22-24-28-33-37-43(46)52-41(39-51-53(47,48)49)38-50-42(45)36-32-29-25-27-31-35-40(44)34-30-26-23-21-12-10-8-6-4-2/h11-13,15-16,18-19,21,25-27,30-31,35,40-41,44H,3-10,14,17,20,22-24,28-29,32-34,36-39H2,1-2H3,(H2,47,48,49)/b13-11-,16-15-,19-18-,21-12-,27-25+,30-26-,35-31-/t40?,41-/m1/s1 |
| InChIKey | UZEOFTRQHRUYCX-WNMRIGLLSA-N |
| XLogP | 11.04 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.01 |
| LogP ≤ 5 | 11.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|