C43H69O9P — CID 156968590
[(2R)-1-[(5Z,8Z)-10-[3-[(Z)-oct-2-enyl]oxiran-2-yl]deca-5,8-dienoyl]oxy-3-phosphonooxypropan-2-yl] (8Z,11Z,14Z,17Z)-icosa-8,11,14,17-tetraenoate (PubChem CID 156968590) has the molecular formula C43H69O9P and a molecular weight of 760.99 g/mol. Its IUPAC name is [(2R)-1-[(5Z,8Z)-10-[3-[(Z)-oct-2-enyl]oxiran-2-yl]deca-5,8-dienoyl]oxy-3-phosphonooxypropan-2-yl] (8Z,11Z,14Z,17Z)-icosa-8,11,14,17-tetraenoate.
| Compound Name | [(2R)-1-[(5Z,8Z)-10-[3-[(Z)-oct-2-enyl]oxiran-2-yl]deca-5,8-dienoyl]oxy-3-phosphonooxypropan-2-yl] (8Z,11Z,14Z,17Z)-icosa-8,11,14,17-tetraenoate |
|---|---|
| PubChem CID | 156968590 |
| Molecular Formula | C43H69O9P |
| Molecular Weight | 760.99 g/mol |
| Exact Mass | 760.47 |
| IUPAC Name | [(2R)-1-[(5Z,8Z)-10-[3-[(Z)-oct-2-enyl]oxiran-2-yl]deca-5,8-dienoyl]oxy-3-phosphonooxypropan-2-yl] (8Z,11Z,14Z,17Z)-icosa-8,11,14,17-tetraenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\CCCCCCC(=O)O[C@H](COC(=O)CCC/C=C\C/C=C\CC1OC1C/C=C\CCCCC)COP(=O)(O)O |
| InChI | InChI=1S/C43H69O9P/c1-3-5-7-9-11-12-13-14-15-16-17-18-19-20-23-28-32-36-43(45)51-39(38-50-53(46,47)48)37-49-42(44)35-31-27-24-21-22-26-30-34-41-40(52-41)33-29-25-10-8-6-4-2/h5,7,11-12,14-15,17-18,21,24-26,29-30,39-41H,3-4,6,8-10,13,16,19-20,22-23,27-28,31-38H2,1-2H3,(H2,46,47,48)/b7-5-,12-11-,15-14-,18-17-,24-21-,29-25-,30-26-/t39-,40?,41?/m1/s1 |
| InChIKey | IZTOMSUQVZBDTF-JRYMRIIPSA-N |
| XLogP | 11.05 |
| TPSA | 131.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.99 |
| LogP ≤ 5 | 11.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|