C31H53O9P — CID 156969938
[(2R)-2-octanoyloxy-3-phosphonooxypropyl] (5Z,8Z)-10-[3-[(Z)-oct-2-enyl]oxiran-2-yl]deca-5,8-dienoate (PubChem CID 156969938) has the molecular formula C31H53O9P and a molecular weight of 600.73 g/mol. Its IUPAC name is [(2R)-2-octanoyloxy-3-phosphonooxypropyl] (5Z,8Z)-10-[3-[(Z)-oct-2-enyl]oxiran-2-yl]deca-5,8-dienoate.
| Compound Name | [(2R)-2-octanoyloxy-3-phosphonooxypropyl] (5Z,8Z)-10-[3-[(Z)-oct-2-enyl]oxiran-2-yl]deca-5,8-dienoate |
|---|---|
| PubChem CID | 156969938 |
| Molecular Formula | C31H53O9P |
| Molecular Weight | 600.73 g/mol |
| Exact Mass | 600.34 |
| IUPAC Name | [(2R)-2-octanoyloxy-3-phosphonooxypropyl] (5Z,8Z)-10-[3-[(Z)-oct-2-enyl]oxiran-2-yl]deca-5,8-dienoate |
| SMILES | CCCCC/C=C\CC1OC1C/C=C\C/C=C\CCCC(=O)OC[C@H](COP(=O)(O)O)OC(=O)CCCCCCC |
| InChI | InChI=1S/C31H53O9P/c1-3-5-7-9-14-17-21-28-29(40-28)22-18-15-11-10-12-16-19-23-30(32)37-25-27(26-38-41(34,35)36)39-31(33)24-20-13-8-6-4-2/h10,12,14-15,17-18,27-29H,3-9,11,13,16,19-26H2,1-2H3,(H2,34,35,36)/b12-10-,17-14-,18-15-/t27-,28?,29?/m1/s1 |
| InChIKey | DPXIZBQMJIPUCY-CEXHAWAJSA-N |
| XLogP | 7.27 |
| TPSA | 131.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.73 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|