C33H57O9P — CID 156965995
[(2R)-3-phosphonooxy-2-[(Z)-7-[3-[(2Z,5Z)-undeca-2,5-dienyl]oxiran-2-yl]hept-5-enoyl]oxypropyl] decanoate (PubChem CID 156965995) has the molecular formula C33H57O9P and a molecular weight of 628.78 g/mol. Its IUPAC name is [(2R)-3-phosphonooxy-2-[(Z)-7-[3-[(2Z,5Z)-undeca-2,5-dienyl]oxiran-2-yl]hept-5-enoyl]oxypropyl] decanoate.
| Compound Name | [(2R)-3-phosphonooxy-2-[(Z)-7-[3-[(2Z,5Z)-undeca-2,5-dienyl]oxiran-2-yl]hept-5-enoyl]oxypropyl] decanoate |
|---|---|
| PubChem CID | 156965995 |
| Molecular Formula | C33H57O9P |
| Molecular Weight | 628.78 g/mol |
| Exact Mass | 628.37 |
| IUPAC Name | [(2R)-3-phosphonooxy-2-[(Z)-7-[3-[(2Z,5Z)-undeca-2,5-dienyl]oxiran-2-yl]hept-5-enoyl]oxypropyl] decanoate |
| SMILES | CCCCC/C=C\C/C=C\CC1OC1C/C=C\CCCC(=O)O[C@H](COC(=O)CCCCCCCCC)COP(=O)(O)O |
| InChI | InChI=1S/C33H57O9P/c1-3-5-7-9-11-12-14-15-19-23-30-31(42-30)24-20-17-18-22-26-33(35)41-29(28-40-43(36,37)38)27-39-32(34)25-21-16-13-10-8-6-4-2/h11-12,15,17,19-20,29-31H,3-10,13-14,16,18,21-28H2,1-2H3,(H2,36,37,38)/b12-11-,19-15-,20-17-/t29-,30?,31?/m1/s1 |
| InChIKey | JWFCZKYABABSJR-TWARKENXSA-N |
| XLogP | 8.05 |
| TPSA | 131.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.78 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|