C41H71O9P — CID 156967032
[(2R)-1-[(5Z,8Z)-10-[3-[(Z)-oct-2-enyl]oxiran-2-yl]deca-5,8-dienoyl]oxy-3-phosphonooxypropan-2-yl] (Z)-octadec-11-enoate (PubChem CID 156967032) has the molecular formula C41H71O9P and a molecular weight of 738.98 g/mol. Its IUPAC name is [(2R)-1-[(5Z,8Z)-10-[3-[(Z)-oct-2-enyl]oxiran-2-yl]deca-5,8-dienoyl]oxy-3-phosphonooxypropan-2-yl] (Z)-octadec-11-enoate.
| Compound Name | [(2R)-1-[(5Z,8Z)-10-[3-[(Z)-oct-2-enyl]oxiran-2-yl]deca-5,8-dienoyl]oxy-3-phosphonooxypropan-2-yl] (Z)-octadec-11-enoate |
|---|---|
| PubChem CID | 156967032 |
| Molecular Formula | C41H71O9P |
| Molecular Weight | 738.98 g/mol |
| Exact Mass | 738.48 |
| IUPAC Name | [(2R)-1-[(5Z,8Z)-10-[3-[(Z)-oct-2-enyl]oxiran-2-yl]deca-5,8-dienoyl]oxy-3-phosphonooxypropan-2-yl] (Z)-octadec-11-enoate |
| SMILES | CCCCC/C=C\CC1OC1C/C=C\C/C=C\CCCC(=O)OC[C@H](COP(=O)(O)O)OC(=O)CCCCCCCCC/C=C\CCCCCC |
| InChI | InChI=1S/C41H71O9P/c1-3-5-7-9-11-12-13-14-15-16-17-18-21-26-30-34-41(43)49-37(36-48-51(44,45)46)35-47-40(42)33-29-25-22-19-20-24-28-32-39-38(50-39)31-27-23-10-8-6-4-2/h12-13,19,22-24,27-28,37-39H,3-11,14-18,20-21,25-26,29-36H2,1-2H3,(H2,44,45,46)/b13-12-,22-19-,27-23-,28-24-/t37-,38?,39?/m1/s1 |
| InChIKey | AXWVJVOETOITAR-ZCQPOIEWSA-N |
| XLogP | 10.95 |
| TPSA | 131.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.98 |
| LogP ≤ 5 | 10.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|