C27H41O10P — CID 156969920
[(2R)-2-acetyloxy-3-phosphonooxypropyl] (4Z,7Z,10S,11E,13Z,15E,17R,19Z)-10,17-dihydroxydocosa-4,7,11,13,15,19-hexaenoate (PubChem CID 156969920) has the molecular formula C27H41O10P and a molecular weight of 556.59 g/mol. Its IUPAC name is [(2R)-2-acetyloxy-3-phosphonooxypropyl] (4Z,7Z,10S,11E,13Z,15E,17R,19Z)-10,17-dihydroxydocosa-4,7,11,13,15,19-hexaenoate.
| Compound Name | [(2R)-2-acetyloxy-3-phosphonooxypropyl] (4Z,7Z,10S,11E,13Z,15E,17R,19Z)-10,17-dihydroxydocosa-4,7,11,13,15,19-hexaenoate |
|---|---|
| PubChem CID | 156969920 |
| Molecular Formula | C27H41O10P |
| Molecular Weight | 556.59 g/mol |
| Exact Mass | 556.24 |
| IUPAC Name | [(2R)-2-acetyloxy-3-phosphonooxypropyl] (4Z,7Z,10S,11E,13Z,15E,17R,19Z)-10,17-dihydroxydocosa-4,7,11,13,15,19-hexaenoate |
| SMILES | CC/C=C\C[C@@H](O)/C=C/C=C\C=C\[C@@H](O)C/C=C\C/C=C\CCC(=O)OC[C@H](COP(=O)(O)O)OC(C)=O |
| InChI | InChI=1S/C27H41O10P/c1-3-4-11-16-24(29)18-13-9-10-14-19-25(30)17-12-7-5-6-8-15-20-27(31)35-21-26(37-23(2)28)22-36-38(32,33)34/h4,6-14,18-19,24-26,29-30H,3,5,15-17,20-22H2,1-2H3,(H2,32,33,34)/b8-6-,10-9-,11-4-,12-7-,18-13+,19-14+/t24-,25+,26-/m1/s1 |
| InChIKey | XCKYMWJKFDLJSW-LBOGUZOWSA-N |
| XLogP | 3.99 |
| TPSA | 159.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.59 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|