C29H51O9P — CID 156970029
[(2R)-1-octanoyloxy-3-phosphonooxypropan-2-yl] (9E,11E,15E)-13-hydroxyoctadeca-9,11,15-trienoate (PubChem CID 156970029) has the molecular formula C29H51O9P and a molecular weight of 574.69 g/mol. Its IUPAC name is [(2R)-1-octanoyloxy-3-phosphonooxypropan-2-yl] (9E,11E,15E)-13-hydroxyoctadeca-9,11,15-trienoate.
| Compound Name | [(2R)-1-octanoyloxy-3-phosphonooxypropan-2-yl] (9E,11E,15E)-13-hydroxyoctadeca-9,11,15-trienoate |
|---|---|
| PubChem CID | 156970029 |
| Molecular Formula | C29H51O9P |
| Molecular Weight | 574.69 g/mol |
| Exact Mass | 574.33 |
| IUPAC Name | [(2R)-1-octanoyloxy-3-phosphonooxypropan-2-yl] (9E,11E,15E)-13-hydroxyoctadeca-9,11,15-trienoate |
| SMILES | CC/C=C/CC(O)/C=C/C=C/CCCCCCCC(=O)O[C@H](COC(=O)CCCCCCC)COP(=O)(O)O |
| InChI | InChI=1S/C29H51O9P/c1-3-5-7-13-18-22-28(31)36-24-27(25-37-39(33,34)35)38-29(32)23-19-15-12-10-8-9-11-14-17-21-26(30)20-16-6-4-2/h6,11,14,16-17,21,26-27,30H,3-5,7-10,12-13,15,18-20,22-25H2,1-2H3,(H2,33,34,35)/b14-11+,16-6+,21-17+/t26?,27-/m1/s1 |
| InChIKey | FEKYJDMFQIRSLF-ANBOQQQNSA-N |
| XLogP | 6.47 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.69 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|