C47H80NO10P — CID 156988104
[(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(5Z,8Z)-10-[3-[(Z)-oct-2-enyl]oxiran-2-yl]deca-5,8-dienoyl]oxypropyl] 11-(3,4-dimethyl-5-pentylfuran-2-yl)undecanoate (PubChem CID 156988104) has the molecular formula C47H80NO10P and a molecular weight of 850.13 g/mol. Its IUPAC name is [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(5Z,8Z)-10-[3-[(Z)-oct-2-enyl]oxiran-2-yl]deca-5,8-dienoyl]oxypropyl] 11-(3,4-dimethyl-5-pentylfuran-2-yl)undecanoate.
| Compound Name | [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(5Z,8Z)-10-[3-[(Z)-oct-2-enyl]oxiran-2-yl]deca-5,8-dienoyl]oxypropyl] 11-(3,4-dimethyl-5-pentylfuran-2-yl)undecanoate |
|---|---|
| PubChem CID | 156988104 |
| Molecular Formula | C47H80NO10P |
| Molecular Weight | 850.13 g/mol |
| Exact Mass | 849.55 |
| IUPAC Name | [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(5Z,8Z)-10-[3-[(Z)-oct-2-enyl]oxiran-2-yl]deca-5,8-dienoyl]oxypropyl] 11-(3,4-dimethyl-5-pentylfuran-2-yl)undecanoate |
| SMILES | CCCCC/C=C\CC1OC1C/C=C\C/C=C\CCCC(=O)O[C@H](COC(=O)CCCCCCCCCCc1oc(CCCCC)c(C)c1C)COP(=O)(O)OCCN |
| InChI | InChI=1S/C47H80NO10P/c1-5-7-9-10-18-25-31-44-45(58-44)32-26-20-15-13-17-22-28-34-47(50)56-41(38-55-59(51,52)54-36-35-48)37-53-46(49)33-27-21-16-12-11-14-19-24-30-43-40(4)39(3)42(57-43)29-23-8-6-2/h13,17-18,20,25-26,41,44-45H,5-12,14-16,19,21-24,27-38,48H2,1-4H3,(H,51,52)/b17-13-,25-18-,26-20-/t41-,44?,45?/m1/s1 |
| InChIKey | NIBWGXMPVMSUDV-DRGFJVCISA-N |
| XLogP | 11.59 |
| TPSA | 160.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 850.13 |
| LogP ≤ 5 | 11.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|