C43H76NO10P — CID 156988476
[(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[9-(3,4-dimethyl-5-pentylfuran-2-yl)nonanoyloxy]propan-2-yl] (Z)-11-(3-pentyloxiran-2-yl)undec-9-enoate (PubChem CID 156988476) has the molecular formula C43H76NO10P and a molecular weight of 798.05 g/mol. Its IUPAC name is [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[9-(3,4-dimethyl-5-pentylfuran-2-yl)nonanoyloxy]propan-2-yl] (Z)-11-(3-pentyloxiran-2-yl)undec-9-enoate.
| Compound Name | [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[9-(3,4-dimethyl-5-pentylfuran-2-yl)nonanoyloxy]propan-2-yl] (Z)-11-(3-pentyloxiran-2-yl)undec-9-enoate |
|---|---|
| PubChem CID | 156988476 |
| Molecular Formula | C43H76NO10P |
| Molecular Weight | 798.05 g/mol |
| Exact Mass | 797.52 |
| IUPAC Name | [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[9-(3,4-dimethyl-5-pentylfuran-2-yl)nonanoyloxy]propan-2-yl] (Z)-11-(3-pentyloxiran-2-yl)undec-9-enoate |
| SMILES | CCCCCc1oc(CCCCCCCCC(=O)OC[C@H](COP(=O)(O)OCCN)OC(=O)CCCCCCC/C=C\CC2OC2CCCCC)c(C)c1C |
| InChI | InChI=1S/C43H76NO10P/c1-5-7-19-25-38-35(3)36(4)39(53-38)26-21-15-13-14-17-23-29-42(45)49-33-37(34-51-55(47,48)50-32-31-44)52-43(46)30-24-18-12-10-9-11-16-22-28-41-40(54-41)27-20-8-6-2/h16,22,37,40-41H,5-15,17-21,23-34,44H2,1-4H3,(H,47,48)/b22-16-/t37-,40?,41?/m1/s1 |
| InChIKey | NJQFQPYCTPNLIT-BJBPXTBASA-N |
| XLogP | 10.47 |
| TPSA | 160.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.05 |
| LogP ≤ 5 | 10.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|