C45H76NO10P — CID 156988418
[(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(Z)-7-[3-[(2Z,5Z)-undeca-2,5-dienyl]oxiran-2-yl]hept-5-enoyl]oxypropyl] 9-(3,4-dimethyl-5-pentylfuran-2-yl)nonanoate (PubChem CID 156988418) has the molecular formula C45H76NO10P and a molecular weight of 822.07 g/mol. Its IUPAC name is [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(Z)-7-[3-[(2Z,5Z)-undeca-2,5-dienyl]oxiran-2-yl]hept-5-enoyl]oxypropyl] 9-(3,4-dimethyl-5-pentylfuran-2-yl)nonanoate.
| Compound Name | [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(Z)-7-[3-[(2Z,5Z)-undeca-2,5-dienyl]oxiran-2-yl]hept-5-enoyl]oxypropyl] 9-(3,4-dimethyl-5-pentylfuran-2-yl)nonanoate |
|---|---|
| PubChem CID | 156988418 |
| Molecular Formula | C45H76NO10P |
| Molecular Weight | 822.07 g/mol |
| Exact Mass | 821.52 |
| IUPAC Name | [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(Z)-7-[3-[(2Z,5Z)-undeca-2,5-dienyl]oxiran-2-yl]hept-5-enoyl]oxypropyl] 9-(3,4-dimethyl-5-pentylfuran-2-yl)nonanoate |
| SMILES | CCCCC/C=C\C/C=C\CC1OC1C/C=C\CCCC(=O)O[C@H](COC(=O)CCCCCCCCc1oc(CCCCC)c(C)c1C)COP(=O)(O)OCCN |
| InChI | InChI=1S/C45H76NO10P/c1-5-7-9-10-11-12-13-17-23-29-42-43(56-42)30-24-19-20-26-32-45(48)54-39(36-53-57(49,50)52-34-33-46)35-51-44(47)31-25-18-15-14-16-22-28-41-38(4)37(3)40(55-41)27-21-8-6-2/h11-12,17,19,23-24,39,42-43H,5-10,13-16,18,20-22,25-36,46H2,1-4H3,(H,49,50)/b12-11-,23-17-,24-19-/t39-,42?,43?/m1/s1 |
| InChIKey | DAVMRNIZERCZQG-PETLVEDKSA-N |
| XLogP | 10.81 |
| TPSA | 160.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.07 |
| LogP ≤ 5 | 10.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|