C43H72NO10P — CID 156988310
[(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[9-(3,4-dimethyl-5-propylfuran-2-yl)nonanoyloxy]propan-2-yl] (5Z,8Z,11Z)-13-(3-pentyloxiran-2-yl)trideca-5,8,11-trienoate (PubChem CID 156988310) has the molecular formula C43H72NO10P and a molecular weight of 794.02 g/mol. Its IUPAC name is [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[9-(3,4-dimethyl-5-propylfuran-2-yl)nonanoyloxy]propan-2-yl] (5Z,8Z,11Z)-13-(3-pentyloxiran-2-yl)trideca-5,8,11-trienoate.
| Compound Name | [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[9-(3,4-dimethyl-5-propylfuran-2-yl)nonanoyloxy]propan-2-yl] (5Z,8Z,11Z)-13-(3-pentyloxiran-2-yl)trideca-5,8,11-trienoate |
|---|---|
| PubChem CID | 156988310 |
| Molecular Formula | C43H72NO10P |
| Molecular Weight | 794.02 g/mol |
| Exact Mass | 793.49 |
| IUPAC Name | [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[9-(3,4-dimethyl-5-propylfuran-2-yl)nonanoyloxy]propan-2-yl] (5Z,8Z,11Z)-13-(3-pentyloxiran-2-yl)trideca-5,8,11-trienoate |
| SMILES | CCCCCC1OC1C/C=C\C/C=C\C/C=C\CCCC(=O)O[C@H](COC(=O)CCCCCCCCc1oc(CCC)c(C)c1C)COP(=O)(O)OCCN |
| InChI | InChI=1S/C43H72NO10P/c1-5-7-20-27-40-41(54-40)28-22-17-12-10-8-9-11-13-19-24-30-43(46)52-37(34-51-55(47,48)50-32-31-44)33-49-42(45)29-23-18-15-14-16-21-26-39-36(4)35(3)38(53-39)25-6-2/h8,10-11,13,17,22,37,40-41H,5-7,9,12,14-16,18-21,23-34,44H2,1-4H3,(H,47,48)/b10-8-,13-11-,22-17-/t37-,40?,41?/m1/s1 |
| InChIKey | BMNXXHXLPGAGMP-MAERRKDESA-N |
| XLogP | 10.03 |
| TPSA | 160.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.02 |
| LogP ≤ 5 | 10.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|