C17H17ClN4O — CID 157016988
4-[[6-(4-chlorophenyl)-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl]methyl]-3,5-dimethyl-1,2-oxazole (PubChem CID 157016988) has the molecular formula C17H17ClN4O and a molecular weight of 328.80 g/mol. Its IUPAC name is 4-[[6-(4-chlorophenyl)-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl]methyl]-3,5-dimethyl-1,2-oxazole.
| Compound Name | 4-[[6-(4-chlorophenyl)-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl]methyl]-3,5-dimethyl-1,2-oxazole |
|---|---|
| PubChem CID | 157016988 |
| Molecular Formula | C17H17ClN4O |
| Molecular Weight | 328.80 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 4-[[6-(4-chlorophenyl)-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl]methyl]-3,5-dimethyl-1,2-oxazole |
| SMILES | Cc1noc(C)c1Cc1nnc2n1CC(c1ccc(Cl)cc1)C2 |
| InChI | InChI=1S/C17H17ClN4O/c1-10-15(11(2)23-21-10)8-17-20-19-16-7-13(9-22(16)17)12-3-5-14(18)6-4-12/h3-6,13H,7-9H2,1-2H3 |
| InChIKey | RDQVCSVQMMVIEY-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.80 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |