About N-[5-(3,4,5-trimethoxyphenyl)-1H-pyrazol-3-yl]quinoxaline-5-carboxamide
N-[5-(3,4,5-trimethoxyphenyl)-1H-pyrazol-3-yl]quinoxaline-5-carboxamide (PubChem CID 157019775) has the molecular formula C21H19N5O4
and a molecular weight of 405.41 g/mol. Its IUPAC name is N-[5-(3,4,5-trimethoxyphenyl)-1H-pyrazol-3-yl]quinoxaline-5-carboxamide.
Molecular Properties
| Compound Name | N-[5-(3,4,5-trimethoxyphenyl)-1H-pyrazol-3-yl]quinoxaline-5-carboxamide |
| PubChem CID | 157019775 |
| Molecular Formula | C21H19N5O4 |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | N-[5-(3,4,5-trimethoxyphenyl)-1H-pyrazol-3-yl]quinoxaline-5-carboxamide |
| SMILES | COc1cc(-c2cc(NC(=O)c3cccc4nccnc34)n[nH]2)cc(OC)c1OC |
| InChI | InChI=1S/C21H19N5O4/c1-28-16-9-12(10-17(29-2)20(16)30-3)15-11-18(26-25-15)24-21(27)13-5-4-6-14-19(13)23-8-7-22-14/h4-11H,1-3H3,(H2,24,25,26,27) |
| InChIKey | MLNZJPLGCOQVGV-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 111.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-[5-(3,4,5-trimethoxyphenyl)-1H-pyrazol-3-yl]quinoxaline-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-(3,4,5-trimethoxyphenyl)-1H-pyrazol-3-yl]quinoxaline-5-carboxamide?
The IUPAC name of N-[5-(3,4,5-trimethoxyphenyl)-1H-pyrazol-3-yl]quinoxaline-5-carboxamide (CID 157019775) is N-[5-(3,4,5-trimethoxyphenyl)-1H-pyrazol-3-yl]quinoxaline-5-carboxamide.
What is the SMILES notation for N-[5-(3,4,5-trimethoxyphenyl)-1H-pyrazol-3-yl]quinoxaline-5-carboxamide?
The canonical SMILES for N-[5-(3,4,5-trimethoxyphenyl)-1H-pyrazol-3-yl]quinoxaline-5-carboxamide is COc1cc(-c2cc(NC(=O)c3cccc4nccnc34)n[nH]2)cc(OC)c1OC.
What is the InChIKey of N-[5-(3,4,5-trimethoxyphenyl)-1H-pyrazol-3-yl]quinoxaline-5-carboxamide?
The InChIKey is MLNZJPLGCOQVGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19N5O4/c1-28-16-9-12(10-17(29-2)20(16)30-3)15-11-18(26-25-15)24-21(27)13-5-4-6-14-19(13)23-8-7-22-14/h4-11H,1-3H3,(H2,24,25,26,27).
What are the key properties of N-[5-(3,4,5-trimethoxyphenyl)-1H-pyrazol-3-yl]quinoxaline-5-carboxamide?
N-[5-(3,4,5-trimethoxyphenyl)-1H-pyrazol-3-yl]quinoxaline-5-carboxamide has a molecular weight of 405.41 g/mol, XLogP of 3.30, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-(3,4,5-trimethoxyphenyl)-1H-pyrazol-3-yl]quinoxaline-5-carboxamide is sourced from PubChem (CID 157019775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).