C11H15F2NO — CID 157032682
3,3-difluoro-4-[(3Z)-5-methoxyhexa-1,3,5-trien-2-yl]pyrrolidine (PubChem CID 157032682) has the molecular formula C11H15F2NO and a molecular weight of 215.24 g/mol. Its IUPAC name is 3,3-difluoro-4-[(3Z)-5-methoxyhexa-1,3,5-trien-2-yl]pyrrolidine.
| Compound Name | 3,3-difluoro-4-[(3Z)-5-methoxyhexa-1,3,5-trien-2-yl]pyrrolidine |
|---|---|
| PubChem CID | 157032682 |
| Molecular Formula | C11H15F2NO |
| Molecular Weight | 215.24 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 3,3-difluoro-4-[(3Z)-5-methoxyhexa-1,3,5-trien-2-yl]pyrrolidine |
| SMILES | C=C(/C=C\C(=C)C1CNCC1(F)F)OC |
| InChI | InChI=1S/C11H15F2NO/c1-8(4-5-9(2)15-3)10-6-14-7-11(10,12)13/h4-5,10,14H,1-2,6-7H2,3H3/b5-4- |
| InChIKey | CMIHUBCLXIAWQY-PLNGDYQASA-N |
| XLogP | 2.11 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.24 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|