About 6-chloro-8-cyclopropyl-3-fluoroimidazo[1,2-b]pyridazine;3-fluorobenzonitrile
6-chloro-8-cyclopropyl-3-fluoroimidazo[1,2-b]pyridazine;3-fluorobenzonitrile (PubChem CID 157034762) has the molecular formula C16H11ClF2N4
and a molecular weight of 332.74 g/mol. Its IUPAC name is 6-chloro-8-cyclopropyl-3-fluoroimidazo[1,2-b]pyridazine;3-fluorobenzonitrile.
Molecular Properties
| Compound Name | 6-chloro-8-cyclopropyl-3-fluoroimidazo[1,2-b]pyridazine;3-fluorobenzonitrile |
| PubChem CID | 157034762 |
| Molecular Formula | C16H11ClF2N4 |
| Molecular Weight | 332.74 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | 6-chloro-8-cyclopropyl-3-fluoroimidazo[1,2-b]pyridazine;3-fluorobenzonitrile |
| SMILES | Fc1cnc2c(C3CC3)cc(Cl)nn12.N#Cc1cccc(F)c1 |
| InChI | InChI=1S/C9H7ClFN3.C7H4FN/c10-7-3-6(5-1-2-5)9-12-4-8(11)14(9)13-7;8-7-3-1-2-6(4-7)5-9/h3-5H,1-2H2;1-4H |
| InChIKey | KGSCLMZLGLZAHI-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 53.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.74 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-chloro-8-cyclopropyl-3-fluoroimidazo[1,2-b]pyridazine;3-fluorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-8-cyclopropyl-3-fluoroimidazo[1,2-b]pyridazine;3-fluorobenzonitrile?
The IUPAC name of 6-chloro-8-cyclopropyl-3-fluoroimidazo[1,2-b]pyridazine;3-fluorobenzonitrile (CID 157034762) is 6-chloro-8-cyclopropyl-3-fluoroimidazo[1,2-b]pyridazine;3-fluorobenzonitrile.
What is the SMILES notation for 6-chloro-8-cyclopropyl-3-fluoroimidazo[1,2-b]pyridazine;3-fluorobenzonitrile?
The canonical SMILES for 6-chloro-8-cyclopropyl-3-fluoroimidazo[1,2-b]pyridazine;3-fluorobenzonitrile is Fc1cnc2c(C3CC3)cc(Cl)nn12.N#Cc1cccc(F)c1.
What is the InChIKey of 6-chloro-8-cyclopropyl-3-fluoroimidazo[1,2-b]pyridazine;3-fluorobenzonitrile?
The InChIKey is KGSCLMZLGLZAHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7ClFN3.C7H4FN/c10-7-3-6(5-1-2-5)9-12-4-8(11)14(9)13-7;8-7-3-1-2-6(4-7)5-9/h3-5H,1-2H2;1-4H.
What are the key properties of 6-chloro-8-cyclopropyl-3-fluoroimidazo[1,2-b]pyridazine;3-fluorobenzonitrile?
6-chloro-8-cyclopropyl-3-fluoroimidazo[1,2-b]pyridazine;3-fluorobenzonitrile has a molecular weight of 332.74 g/mol, XLogP of 4.10, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-8-cyclopropyl-3-fluoroimidazo[1,2-b]pyridazine;3-fluorobenzonitrile is sourced from PubChem (CID 157034762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).