C21H22Cl2N2O5 — CID 157035775
(2S)-3-(2,6-dichloro-4-phenylanilino)-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-3-oxopropanoic acid (PubChem CID 157035775) has the molecular formula C21H22Cl2N2O5 and a molecular weight of 453.32 g/mol. Its IUPAC name is (2S)-3-(2,6-dichloro-4-phenylanilino)-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-3-oxopropanoic acid.
| Compound Name | (2S)-3-(2,6-dichloro-4-phenylanilino)-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 157035775 |
| Molecular Formula | C21H22Cl2N2O5 |
| Molecular Weight | 453.32 g/mol |
| Exact Mass | 452.09 |
| IUPAC Name | (2S)-3-(2,6-dichloro-4-phenylanilino)-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-3-oxopropanoic acid |
| SMILES | CC(C)(C)OC(=O)NC[C@H](C(=O)O)C(=O)Nc1c(Cl)cc(-c2ccccc2)cc1Cl |
| InChI | InChI=1S/C21H22Cl2N2O5/c1-21(2,3)30-20(29)24-11-14(19(27)28)18(26)25-17-15(22)9-13(10-16(17)23)12-7-5-4-6-8-12/h4-10,14H,11H2,1-3H3,(H,24,29)(H,25,26)(H,27,28)/t14-/m0/s1 |
| InChIKey | CJUVHMUFSLMQBQ-AWEZNQCLSA-N |
| XLogP | 4.82 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.32 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|